C10H8N4O5 — CID 5299575
5-(1,3-benzodioxol-5-yloxy)-1-methyl-3-nitro-1,2,4-triazole (PubChem CID 5299575) has the molecular formula C10H8N4O5 and a molecular weight of 264.20 g/mol. Its IUPAC name is 5-(1,3-benzodioxol-5-yloxy)-1-methyl-3-nitro-1,2,4-triazole.
| Compound Name | 5-(1,3-benzodioxol-5-yloxy)-1-methyl-3-nitro-1,2,4-triazole |
|---|---|
| PubChem CID | 5299575 |
| Molecular Formula | C10H8N4O5 |
| Molecular Weight | 264.20 g/mol |
| Exact Mass | 264.05 |
| IUPAC Name | 5-(1,3-benzodioxol-5-yloxy)-1-methyl-3-nitro-1,2,4-triazole |
| SMILES | Cn1nc([N+](=O)[O-])nc1Oc1ccc2c(c1)OCO2 |
| InChI | InChI=1S/C10H8N4O5/c1-13-10(11-9(12-13)14(15)16)19-6-2-3-7-8(4-6)18-5-17-7/h2-4H,5H2,1H3 |
| InChIKey | JPFYJENBZNJCOY-UHFFFAOYSA-N |
| XLogP | 1.24 |
| TPSA | 101.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.20 |
| LogP ≤ 5 | 1.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|