C11H8N2O4 — CID 103241265
4-(1,3-benzodioxol-5-yloxy)-1H-pyridazin-6-one (PubChem CID 103241265) has the molecular formula C11H8N2O4 and a molecular weight of 232.19 g/mol. Its IUPAC name is 4-(1,3-benzodioxol-5-yloxy)-1H-pyridazin-6-one.
| Compound Name | 4-(1,3-benzodioxol-5-yloxy)-1H-pyridazin-6-one |
|---|---|
| PubChem CID | 103241265 |
| Molecular Formula | C11H8N2O4 |
| Molecular Weight | 232.19 g/mol |
| Exact Mass | 232.05 |
| IUPAC Name | 4-(1,3-benzodioxol-5-yloxy)-1H-pyridazin-6-one |
| SMILES | O=c1cc(Oc2ccc3c(c2)OCO3)cn[nH]1 |
| InChI | InChI=1S/C11H8N2O4/c14-11-4-8(5-12-13-11)17-7-1-2-9-10(3-7)16-6-15-9/h1-5H,6H2,(H,13,14) |
| InChIKey | UGWGOEGMOIZCIX-UHFFFAOYSA-N |
| XLogP | 1.29 |
| TPSA | 73.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 232.19 |
| LogP ≤ 5 | 1.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |