C12H8ClNO5S — CID 115928074
6-(1,3-benzodioxol-5-yloxy)pyridine-3-sulfonyl chloride (PubChem CID 115928074) has the molecular formula C12H8ClNO5S and a molecular weight of 313.72 g/mol. Its IUPAC name is 6-(1,3-benzodioxol-5-yloxy)pyridine-3-sulfonyl chloride.
| Compound Name | 6-(1,3-benzodioxol-5-yloxy)pyridine-3-sulfonyl chloride |
|---|---|
| PubChem CID | 115928074 |
| Molecular Formula | C12H8ClNO5S |
| Molecular Weight | 313.72 g/mol |
| Exact Mass | 312.98 |
| IUPAC Name | 6-(1,3-benzodioxol-5-yloxy)pyridine-3-sulfonyl chloride |
| SMILES | O=S(=O)(Cl)c1ccc(Oc2ccc3c(c2)OCO3)nc1 |
| InChI | InChI=1S/C12H8ClNO5S/c13-20(15,16)9-2-4-12(14-6-9)19-8-1-3-10-11(5-8)18-7-17-10/h1-6H,7H2 |
| InChIKey | KQPKLVWIEVITOD-UHFFFAOYSA-N |
| XLogP | 2.53 |
| TPSA | 74.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.72 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |