About 1-[4-(1,3-benzodioxol-5-yloxy)-2,6-dimethylphenyl]-2-bromoethanone
1-[4-(1,3-benzodioxol-5-yloxy)-2,6-dimethylphenyl]-2-bromoethanone (PubChem CID 58442393) has the molecular formula C17H15BrO4
and a molecular weight of 363.21 g/mol. Its IUPAC name is 1-[4-(1,3-benzodioxol-5-yloxy)-2,6-dimethylphenyl]-2-bromoethanone.
Molecular Properties
| Compound Name | 1-[4-(1,3-benzodioxol-5-yloxy)-2,6-dimethylphenyl]-2-bromoethanone |
| PubChem CID | 58442393 |
| Molecular Formula | C17H15BrO4 |
| Molecular Weight | 363.21 g/mol |
| Exact Mass | 362.02 |
| IUPAC Name | 1-[4-(1,3-benzodioxol-5-yloxy)-2,6-dimethylphenyl]-2-bromoethanone |
| SMILES | Cc1cc(Oc2ccc3c(c2)OCO3)cc(C)c1C(=O)CBr |
| InChI | InChI=1S/C17H15BrO4/c1-10-5-13(6-11(2)17(10)14(19)8-18)22-12-3-4-15-16(7-12)21-9-20-15/h3-7H,8-9H2,1-2H3 |
| InChIKey | AIFVMJJGWNBKAC-UHFFFAOYSA-N |
| XLogP | 4.40 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 363.21 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze 1-[4-(1,3-benzodioxol-5-yloxy)-2,6-dimethylphenyl]-2-bromoethanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[4-(1,3-benzodioxol-5-yloxy)-2,6-dimethylphenyl]-2-bromoethanone?
The IUPAC name of 1-[4-(1,3-benzodioxol-5-yloxy)-2,6-dimethylphenyl]-2-bromoethanone (CID 58442393) is 1-[4-(1,3-benzodioxol-5-yloxy)-2,6-dimethylphenyl]-2-bromoethanone.
What is the SMILES notation for 1-[4-(1,3-benzodioxol-5-yloxy)-2,6-dimethylphenyl]-2-bromoethanone?
The canonical SMILES for 1-[4-(1,3-benzodioxol-5-yloxy)-2,6-dimethylphenyl]-2-bromoethanone is Cc1cc(Oc2ccc3c(c2)OCO3)cc(C)c1C(=O)CBr.
What is the InChIKey of 1-[4-(1,3-benzodioxol-5-yloxy)-2,6-dimethylphenyl]-2-bromoethanone?
The InChIKey is AIFVMJJGWNBKAC-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H15BrO4/c1-10-5-13(6-11(2)17(10)14(19)8-18)22-12-3-4-15-16(7-12)21-9-20-15/h3-7H,8-9H2,1-2H3.
What are the key properties of 1-[4-(1,3-benzodioxol-5-yloxy)-2,6-dimethylphenyl]-2-bromoethanone?
1-[4-(1,3-benzodioxol-5-yloxy)-2,6-dimethylphenyl]-2-bromoethanone has a molecular weight of 363.21 g/mol, XLogP of 4.40, 4 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[4-(1,3-benzodioxol-5-yloxy)-2,6-dimethylphenyl]-2-bromoethanone is sourced from PubChem (CID 58442393), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).