C12H9BrN2O3 — CID 107086399
2-(1,3-benzodioxol-5-yloxy)-5-(bromomethyl)pyrimidine (PubChem CID 107086399) has the molecular formula C12H9BrN2O3 and a molecular weight of 309.12 g/mol. Its IUPAC name is 2-(1,3-benzodioxol-5-yloxy)-5-(bromomethyl)pyrimidine.
| Compound Name | 2-(1,3-benzodioxol-5-yloxy)-5-(bromomethyl)pyrimidine |
|---|---|
| PubChem CID | 107086399 |
| Molecular Formula | C12H9BrN2O3 |
| Molecular Weight | 309.12 g/mol |
| Exact Mass | 307.98 |
| IUPAC Name | 2-(1,3-benzodioxol-5-yloxy)-5-(bromomethyl)pyrimidine |
| SMILES | BrCc1cnc(Oc2ccc3c(c2)OCO3)nc1 |
| InChI | InChI=1S/C12H9BrN2O3/c13-4-8-5-14-12(15-6-8)18-9-1-2-10-11(3-9)17-7-16-10/h1-3,5-6H,4,7H2 |
| InChIKey | BKFYUKVAEAUISE-UHFFFAOYSA-N |
| XLogP | 2.89 |
| TPSA | 53.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.12 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|