C13H11BrN2O3 — CID 104507278
6-(1,3-benzodioxol-5-yloxy)-5-bromo-4-methylpyridin-3-amine (PubChem CID 104507278) has the molecular formula C13H11BrN2O3 and a molecular weight of 323.15 g/mol. Its IUPAC name is 6-(1,3-benzodioxol-5-yloxy)-5-bromo-4-methylpyridin-3-amine.
| Compound Name | 6-(1,3-benzodioxol-5-yloxy)-5-bromo-4-methylpyridin-3-amine |
|---|---|
| PubChem CID | 104507278 |
| Molecular Formula | C13H11BrN2O3 |
| Molecular Weight | 323.15 g/mol |
| Exact Mass | 322.00 |
| IUPAC Name | 6-(1,3-benzodioxol-5-yloxy)-5-bromo-4-methylpyridin-3-amine |
| SMILES | Cc1c(N)cnc(Oc2ccc3c(c2)OCO3)c1Br |
| InChI | InChI=1S/C13H11BrN2O3/c1-7-9(15)5-16-13(12(7)14)19-8-2-3-10-11(4-8)18-6-17-10/h2-5H,6,15H2,1H3 |
| InChIKey | NTWXCWCPVVISJQ-UHFFFAOYSA-N |
| XLogP | 3.26 |
| TPSA | 66.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.15 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |