C22H21BrO3 — CID 147083407
2-bromo-1-[4-(4-cyclohexa-1,3-dien-1-yloxyphenoxy)-2,6-dimethylphenyl]ethanone (PubChem CID 147083407) has the molecular formula C22H21BrO3 and a molecular weight of 413.31 g/mol. Its IUPAC name is 2-bromo-1-[4-(4-cyclohexa-1,3-dien-1-yloxyphenoxy)-2,6-dimethylphenyl]ethanone.
| Compound Name | 2-bromo-1-[4-(4-cyclohexa-1,3-dien-1-yloxyphenoxy)-2,6-dimethylphenyl]ethanone |
|---|---|
| PubChem CID | 147083407 |
| Molecular Formula | C22H21BrO3 |
| Molecular Weight | 413.31 g/mol |
| Exact Mass | 412.07 |
| IUPAC Name | 2-bromo-1-[4-(4-cyclohexa-1,3-dien-1-yloxyphenoxy)-2,6-dimethylphenyl]ethanone |
| SMILES | Cc1cc(Oc2ccc(OC3=CC=CCC3)cc2)cc(C)c1C(=O)CBr |
| InChI | InChI=1S/C22H21BrO3/c1-15-12-20(13-16(2)22(15)21(24)14-23)26-19-10-8-18(9-11-19)25-17-6-4-3-5-7-17/h3-4,6,8-13H,5,7,14H2,1-2H3 |
| InChIKey | BHJIIVDDOJQZFZ-UHFFFAOYSA-N |
| XLogP | 6.29 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.31 |
| LogP ≤ 5 | 6.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|