C11H13NO4 — CID 62901253
2-(1,3-benzodioxol-5-yloxy)butanamide (PubChem CID 62901253) has the molecular formula C11H13NO4 and a molecular weight of 223.23 g/mol. Its IUPAC name is 2-(1,3-benzodioxol-5-yloxy)butanamide.
| Compound Name | 2-(1,3-benzodioxol-5-yloxy)butanamide |
|---|---|
| PubChem CID | 62901253 |
| Molecular Formula | C11H13NO4 |
| Molecular Weight | 223.23 g/mol |
| Exact Mass | 223.08 |
| IUPAC Name | 2-(1,3-benzodioxol-5-yloxy)butanamide |
| SMILES | CCC(Oc1ccc2c(c1)OCO2)C(N)=O |
| InChI | InChI=1S/C11H13NO4/c1-2-8(11(12)13)16-7-3-4-9-10(5-7)15-6-14-9/h3-5,8H,2,6H2,1H3,(H2,12,13) |
| InChIKey | APVQAHLUJSQVEG-UHFFFAOYSA-N |
| XLogP | 1.06 |
| TPSA | 70.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 223.23 |
| LogP ≤ 5 | 1.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |