C14H12N2O4 — CID 103241257
4-(1,3-benzodioxol-5-yloxy)-2-cyclopropyl-1H-pyrimidin-6-one (PubChem CID 103241257) has the molecular formula C14H12N2O4 and a molecular weight of 272.26 g/mol. Its IUPAC name is 4-(1,3-benzodioxol-5-yloxy)-2-cyclopropyl-1H-pyrimidin-6-one.
| Compound Name | 4-(1,3-benzodioxol-5-yloxy)-2-cyclopropyl-1H-pyrimidin-6-one |
|---|---|
| PubChem CID | 103241257 |
| Molecular Formula | C14H12N2O4 |
| Molecular Weight | 272.26 g/mol |
| Exact Mass | 272.08 |
| IUPAC Name | 4-(1,3-benzodioxol-5-yloxy)-2-cyclopropyl-1H-pyrimidin-6-one |
| SMILES | O=c1cc(Oc2ccc3c(c2)OCO3)nc(C2CC2)[nH]1 |
| InChI | InChI=1S/C14H12N2O4/c17-12-6-13(16-14(15-12)8-1-2-8)20-9-3-4-10-11(5-9)19-7-18-10/h3-6,8H,1-2,7H2,(H,15,16,17) |
| InChIKey | AIKCQZOBCZPVGF-UHFFFAOYSA-N |
| XLogP | 2.17 |
| TPSA | 73.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.26 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |