About 2-cyclopropyl-4-(2,3-dimethylphenoxy)-1H-pyrimidin-6-one
2-cyclopropyl-4-(2,3-dimethylphenoxy)-1H-pyrimidin-6-one (PubChem CID 103241006) has the molecular formula C15H16N2O2
and a molecular weight of 256.31 g/mol. Its IUPAC name is 2-cyclopropyl-4-(2,3-dimethylphenoxy)-1H-pyrimidin-6-one.
Molecular Properties
| Compound Name | 2-cyclopropyl-4-(2,3-dimethylphenoxy)-1H-pyrimidin-6-one |
| PubChem CID | 103241006 |
| Molecular Formula | C15H16N2O2 |
| Molecular Weight | 256.31 g/mol |
| Exact Mass | 256.12 |
| IUPAC Name | 2-cyclopropyl-4-(2,3-dimethylphenoxy)-1H-pyrimidin-6-one |
| SMILES | Cc1cccc(Oc2cc(=O)[nH]c(C3CC3)n2)c1C |
| InChI | InChI=1S/C15H16N2O2/c1-9-4-3-5-12(10(9)2)19-14-8-13(18)16-15(17-14)11-6-7-11/h3-5,8,11H,6-7H2,1-2H3,(H,16,17,18) |
| InChIKey | WSPDVURGGDCDPU-UHFFFAOYSA-N |
| XLogP | 3.06 |
| TPSA | 54.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 256.31 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-cyclopropyl-4-(2,3-dimethylphenoxy)-1H-pyrimidin-6-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-cyclopropyl-4-(2,3-dimethylphenoxy)-1H-pyrimidin-6-one?
The IUPAC name of 2-cyclopropyl-4-(2,3-dimethylphenoxy)-1H-pyrimidin-6-one (CID 103241006) is 2-cyclopropyl-4-(2,3-dimethylphenoxy)-1H-pyrimidin-6-one.
What is the SMILES notation for 2-cyclopropyl-4-(2,3-dimethylphenoxy)-1H-pyrimidin-6-one?
The canonical SMILES for 2-cyclopropyl-4-(2,3-dimethylphenoxy)-1H-pyrimidin-6-one is Cc1cccc(Oc2cc(=O)[nH]c(C3CC3)n2)c1C.
What is the InChIKey of 2-cyclopropyl-4-(2,3-dimethylphenoxy)-1H-pyrimidin-6-one?
The InChIKey is WSPDVURGGDCDPU-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H16N2O2/c1-9-4-3-5-12(10(9)2)19-14-8-13(18)16-15(17-14)11-6-7-11/h3-5,8,11H,6-7H2,1-2H3,(H,16,17,18).
What are the key properties of 2-cyclopropyl-4-(2,3-dimethylphenoxy)-1H-pyrimidin-6-one?
2-cyclopropyl-4-(2,3-dimethylphenoxy)-1H-pyrimidin-6-one has a molecular weight of 256.31 g/mol, XLogP of 3.06, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-cyclopropyl-4-(2,3-dimethylphenoxy)-1H-pyrimidin-6-one is sourced from PubChem (CID 103241006), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).