C15H16N2O2 — CID 103240966
2-cyclopropyl-4-(2,4-dimethylphenoxy)-1H-pyrimidin-6-one (PubChem CID 103240966) has the molecular formula C15H16N2O2 and a molecular weight of 256.31 g/mol. Its IUPAC name is 2-cyclopropyl-4-(2,4-dimethylphenoxy)-1H-pyrimidin-6-one.
| Compound Name | 2-cyclopropyl-4-(2,4-dimethylphenoxy)-1H-pyrimidin-6-one |
|---|---|
| PubChem CID | 103240966 |
| Molecular Formula | C15H16N2O2 |
| Molecular Weight | 256.31 g/mol |
| Exact Mass | 256.12 |
| IUPAC Name | 2-cyclopropyl-4-(2,4-dimethylphenoxy)-1H-pyrimidin-6-one |
| SMILES | Cc1ccc(Oc2cc(=O)[nH]c(C3CC3)n2)c(C)c1 |
| InChI | InChI=1S/C15H16N2O2/c1-9-3-6-12(10(2)7-9)19-14-8-13(18)16-15(17-14)11-4-5-11/h3,6-8,11H,4-5H2,1-2H3,(H,16,17,18) |
| InChIKey | ZKCNKUZQGMBDQE-UHFFFAOYSA-N |
| XLogP | 3.06 |
| TPSA | 54.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.31 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |