5-(1,3-benzodioxol-5-yloxy)-1H-indole-2-carboxylic acid

C16H11NO5 — CID 5039380

IUPAC5-(1,3-benzodioxol-5-yloxy)-1H-indole-2-carboxylic acid
SMILESO=C(O)c1cc2cc(Oc3ccc4c(c3)OCO4)ccc2[nH]1
InChIInChI=1S/C16H11NO5/c18-16(19)13-6-9-5-10(1-3-12(9)17-13)22-11-2-4-14-15(7-11)21-8-20-14/h1-7,17H,8H2,(H,18,19)
InChIKeyRLSKZPKOSNJBMR-UHFFFAOYSA-N
MW297.27 g/mol
LogP3.39
Rot. Bonds3

About 5-(1,3-benzodioxol-5-yloxy)-1H-indole-2-carboxylic acid

5-(1,3-benzodioxol-5-yloxy)-1H-indole-2-carboxylic acid (PubChem CID 5039380) has the molecular formula C16H11NO5 and a molecular weight of 297.27 g/mol. Its IUPAC name is 5-(1,3-benzodioxol-5-yloxy)-1H-indole-2-carboxylic acid.

Molecular Properties

Compound Name5-(1,3-benzodioxol-5-yloxy)-1H-indole-2-carboxylic acid
PubChem CID5039380
Molecular FormulaC16H11NO5
Molecular Weight297.27 g/mol
Exact Mass297.06
IUPAC Name5-(1,3-benzodioxol-5-yloxy)-1H-indole-2-carboxylic acid
SMILESO=C(O)c1cc2cc(Oc3ccc4c(c3)OCO4)ccc2[nH]1
InChIInChI=1S/C16H11NO5/c18-16(19)13-6-9-5-10(1-3-12(9)17-13)22-11-2-4-14-15(7-11)21-8-20-14/h1-7,17H,8H2,(H,18,19)
InChIKeyRLSKZPKOSNJBMR-UHFFFAOYSA-N
XLogP3.39
TPSA80.78 Ų
H-Bond Donors2
H-Bond Acceptors4
Rotatable Bonds3
Heavy Atoms22
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500297.27
LogP ≤ 53.39
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 104

Analyze 5-(1,3-benzodioxol-5-yloxy)-1H-indole-2-carboxylic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 5-(1,3-benzodioxol-5-yloxy)-1H-indole-2-carboxylic acid?
The IUPAC name of 5-(1,3-benzodioxol-5-yloxy)-1H-indole-2-carboxylic acid (CID 5039380) is 5-(1,3-benzodioxol-5-yloxy)-1H-indole-2-carboxylic acid.
What is the SMILES notation for 5-(1,3-benzodioxol-5-yloxy)-1H-indole-2-carboxylic acid?
The canonical SMILES for 5-(1,3-benzodioxol-5-yloxy)-1H-indole-2-carboxylic acid is O=C(O)c1cc2cc(Oc3ccc4c(c3)OCO4)ccc2[nH]1.
What is the InChIKey of 5-(1,3-benzodioxol-5-yloxy)-1H-indole-2-carboxylic acid?
The InChIKey is RLSKZPKOSNJBMR-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H11NO5/c18-16(19)13-6-9-5-10(1-3-12(9)17-13)22-11-2-4-14-15(7-11)21-8-20-14/h1-7,17H,8H2,(H,18,19).
What are the key properties of 5-(1,3-benzodioxol-5-yloxy)-1H-indole-2-carboxylic acid?
5-(1,3-benzodioxol-5-yloxy)-1H-indole-2-carboxylic acid has a molecular weight of 297.27 g/mol, XLogP of 3.39, 3 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 5-(1,3-benzodioxol-5-yloxy)-1H-indole-2-carboxylic acid is sourced from PubChem (CID 5039380), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).