C10H6ClNO3 — CID 10822981
5H-[1,3]dioxolo[4,5-f]indole-6-carbonyl chloride (PubChem CID 10822981) has the molecular formula C10H6ClNO3 and a molecular weight of 223.61 g/mol. Its IUPAC name is 5H-[1,3]dioxolo[4,5-f]indole-6-carbonyl chloride.
| Compound Name | 5H-[1,3]dioxolo[4,5-f]indole-6-carbonyl chloride |
|---|---|
| PubChem CID | 10822981 |
| Molecular Formula | C10H6ClNO3 |
| Molecular Weight | 223.61 g/mol |
| Exact Mass | 223.00 |
| IUPAC Name | 5H-[1,3]dioxolo[4,5-f]indole-6-carbonyl chloride |
| SMILES | O=C(Cl)c1cc2cc3c(cc2[nH]1)OCO3 |
| InChI | InChI=1S/C10H6ClNO3/c11-10(13)7-1-5-2-8-9(15-4-14-8)3-6(5)12-7/h1-3,12H,4H2 |
| InChIKey | IYEWPLVEZUUFMJ-UHFFFAOYSA-N |
| XLogP | 2.28 |
| TPSA | 51.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 223.61 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'} |
|---|