C11H7BrN4O5 — CID 103098830
1-(1,3-benzodioxol-5-yl)-2-(5-bromo-3-nitro-1,2,4-triazol-1-yl)ethanone (PubChem CID 103098830) has the molecular formula C11H7BrN4O5 and a molecular weight of 355.10 g/mol. Its IUPAC name is 1-(1,3-benzodioxol-5-yl)-2-(5-bromo-3-nitro-1,2,4-triazol-1-yl)ethanone.
| Compound Name | 1-(1,3-benzodioxol-5-yl)-2-(5-bromo-3-nitro-1,2,4-triazol-1-yl)ethanone |
|---|---|
| PubChem CID | 103098830 |
| Molecular Formula | C11H7BrN4O5 |
| Molecular Weight | 355.10 g/mol |
| Exact Mass | 353.96 |
| IUPAC Name | 1-(1,3-benzodioxol-5-yl)-2-(5-bromo-3-nitro-1,2,4-triazol-1-yl)ethanone |
| SMILES | O=C(Cn1nc([N+](=O)[O-])nc1Br)c1ccc2c(c1)OCO2 |
| InChI | InChI=1S/C11H7BrN4O5/c12-10-13-11(16(18)19)14-15(10)4-7(17)6-1-2-8-9(3-6)21-5-20-8/h1-3H,4-5H2 |
| InChIKey | XBRIFXYFEJYBEK-UHFFFAOYSA-N |
| XLogP | 1.56 |
| TPSA | 109.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.10 |
| LogP ≤ 5 | 1.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|