C15H15N5O7 — CID 5301082
2-[5-(1,3-benzodioxol-5-yloxy)-3-nitro-1,2,4-triazol-1-yl]-1-morpholin-4-ylethanone (PubChem CID 5301082) has the molecular formula C15H15N5O7 and a molecular weight of 377.31 g/mol. Its IUPAC name is 2-[5-(1,3-benzodioxol-5-yloxy)-3-nitro-1,2,4-triazol-1-yl]-1-morpholin-4-ylethanone.
| Compound Name | 2-[5-(1,3-benzodioxol-5-yloxy)-3-nitro-1,2,4-triazol-1-yl]-1-morpholin-4-ylethanone |
|---|---|
| PubChem CID | 5301082 |
| Molecular Formula | C15H15N5O7 |
| Molecular Weight | 377.31 g/mol |
| Exact Mass | 377.10 |
| IUPAC Name | 2-[5-(1,3-benzodioxol-5-yloxy)-3-nitro-1,2,4-triazol-1-yl]-1-morpholin-4-ylethanone |
| SMILES | O=C(Cn1nc([N+](=O)[O-])nc1Oc1ccc2c(c1)OCO2)N1CCOCC1 |
| InChI | InChI=1S/C15H15N5O7/c21-13(18-3-5-24-6-4-18)8-19-15(16-14(17-19)20(22)23)27-10-1-2-11-12(7-10)26-9-25-11/h1-2,7H,3-6,8-9H2 |
| InChIKey | HRJUVMRDQVFKHM-UHFFFAOYSA-N |
| XLogP | 0.57 |
| TPSA | 131.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.31 |
| LogP ≤ 5 | 0.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|