C11H13N7O4 — CID 5297429
2-(5-imidazol-1-yl-3-nitro-1,2,4-triazol-1-yl)-1-morpholin-4-ylethanone (PubChem CID 5297429) has the molecular formula C11H13N7O4 and a molecular weight of 307.27 g/mol. Its IUPAC name is 2-(5-imidazol-1-yl-3-nitro-1,2,4-triazol-1-yl)-1-morpholin-4-ylethanone.
| Compound Name | 2-(5-imidazol-1-yl-3-nitro-1,2,4-triazol-1-yl)-1-morpholin-4-ylethanone |
|---|---|
| PubChem CID | 5297429 |
| Molecular Formula | C11H13N7O4 |
| Molecular Weight | 307.27 g/mol |
| Exact Mass | 307.10 |
| IUPAC Name | 2-(5-imidazol-1-yl-3-nitro-1,2,4-triazol-1-yl)-1-morpholin-4-ylethanone |
| SMILES | O=C(Cn1nc([N+](=O)[O-])nc1-n1ccnc1)N1CCOCC1 |
| InChI | InChI=1S/C11H13N7O4/c19-9(15-3-5-22-6-4-15)7-17-11(16-2-1-12-8-16)13-10(14-17)18(20)21/h1-2,8H,3-7H2 |
| InChIKey | ALIQPOWZLXMBFJ-UHFFFAOYSA-N |
| XLogP | -0.77 |
| TPSA | 121.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.27 |
| LogP ≤ 5 | -0.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|