C16H19N9O6S — CID 5295355
1,3,7-trimethyl-8-[[2-(2-morpholin-4-yl-2-oxoethyl)-5-nitro-1,2,4-triazol-3-yl]sulfanyl]purine-2,6-dione (PubChem CID 5295355) has the molecular formula C16H19N9O6S and a molecular weight of 465.45 g/mol. Its IUPAC name is 1,3,7-trimethyl-8-[[2-(2-morpholin-4-yl-2-oxoethyl)-5-nitro-1,2,4-triazol-3-yl]sulfanyl]purine-2,6-dione.
| Compound Name | 1,3,7-trimethyl-8-[[2-(2-morpholin-4-yl-2-oxoethyl)-5-nitro-1,2,4-triazol-3-yl]sulfanyl]purine-2,6-dione |
|---|---|
| PubChem CID | 5295355 |
| Molecular Formula | C16H19N9O6S |
| Molecular Weight | 465.45 g/mol |
| Exact Mass | 465.12 |
| IUPAC Name | 1,3,7-trimethyl-8-[[2-(2-morpholin-4-yl-2-oxoethyl)-5-nitro-1,2,4-triazol-3-yl]sulfanyl]purine-2,6-dione |
| SMILES | Cn1c(=O)c2c(nc(Sc3nc([N+](=O)[O-])nn3CC(=O)N3CCOCC3)n2C)n(C)c1=O |
| InChI | InChI=1S/C16H19N9O6S/c1-20-10-11(21(2)16(28)22(3)12(10)27)17-14(20)32-15-18-13(25(29)30)19-24(15)8-9(26)23-4-6-31-7-5-23/h4-8H2,1-3H3 |
| InChIKey | ZJJALSVXGIGWJK-UHFFFAOYSA-N |
| XLogP | -1.52 |
| TPSA | 165.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.45 |
| LogP ≤ 5 | -1.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 14 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|