C17H20N8O4S2 — CID 3573251
1,3,7-trimethyl-8-[(1,3,7-trimethyl-2,6-dioxopurin-8-yl)sulfanylmethylsulfanyl]purine-2,6-dione (PubChem CID 3573251) has the molecular formula C17H20N8O4S2 and a molecular weight of 464.53 g/mol. Its IUPAC name is 1,3,7-trimethyl-8-[(1,3,7-trimethyl-2,6-dioxopurin-8-yl)sulfanylmethylsulfanyl]purine-2,6-dione.
| Compound Name | 1,3,7-trimethyl-8-[(1,3,7-trimethyl-2,6-dioxopurin-8-yl)sulfanylmethylsulfanyl]purine-2,6-dione |
|---|---|
| PubChem CID | 3573251 |
| Molecular Formula | C17H20N8O4S2 |
| Molecular Weight | 464.53 g/mol |
| Exact Mass | 464.10 |
| IUPAC Name | 1,3,7-trimethyl-8-[(1,3,7-trimethyl-2,6-dioxopurin-8-yl)sulfanylmethylsulfanyl]purine-2,6-dione |
| SMILES | Cn1c(=O)c2c(nc(SCSc3nc4c(c(=O)n(C)c(=O)n4C)n3C)n2C)n(C)c1=O |
| InChI | InChI=1S/C17H20N8O4S2/c1-20-8-10(22(3)16(28)24(5)12(8)26)18-14(20)30-7-31-15-19-11-9(21(15)2)13(27)25(6)17(29)23(11)4/h7H2,1-6H3 |
| InChIKey | JIEZVKNOGDBBON-UHFFFAOYSA-N |
| XLogP | -0.90 |
| TPSA | 123.64 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.53 |
| LogP ≤ 5 | -0.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 14 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|