C12H18N4O2S — CID 5021808
8-ethylsulfanyl-1,3-dimethyl-7-propan-2-ylpurine-2,6-dione (PubChem CID 5021808) has the molecular formula C12H18N4O2S and a molecular weight of 282.37 g/mol. Its IUPAC name is 8-ethylsulfanyl-1,3-dimethyl-7-propan-2-ylpurine-2,6-dione.
| Compound Name | 8-ethylsulfanyl-1,3-dimethyl-7-propan-2-ylpurine-2,6-dione |
|---|---|
| PubChem CID | 5021808 |
| Molecular Formula | C12H18N4O2S |
| Molecular Weight | 282.37 g/mol |
| Exact Mass | 282.12 |
| IUPAC Name | 8-ethylsulfanyl-1,3-dimethyl-7-propan-2-ylpurine-2,6-dione |
| SMILES | CCSc1nc2c(c(=O)n(C)c(=O)n2C)n1C(C)C |
| InChI | InChI=1S/C12H18N4O2S/c1-6-19-11-13-9-8(16(11)7(2)3)10(17)15(5)12(18)14(9)4/h7H,6H2,1-5H3 |
| InChIKey | XFETXDUTCINEHP-UHFFFAOYSA-N |
| XLogP | 1.13 |
| TPSA | 61.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.37 |
| LogP ≤ 5 | 1.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |