C10H13N5O3S — CID 567556
2-(1,3,7-trimethyl-2,6-dioxopurin-8-yl)sulfanylacetamide (PubChem CID 567556) has the molecular formula C10H13N5O3S and a molecular weight of 283.31 g/mol. Its IUPAC name is 2-(1,3,7-trimethyl-2,6-dioxopurin-8-yl)sulfanylacetamide.
| Compound Name | 2-(1,3,7-trimethyl-2,6-dioxopurin-8-yl)sulfanylacetamide |
|---|---|
| PubChem CID | 567556 |
| Molecular Formula | C10H13N5O3S |
| Molecular Weight | 283.31 g/mol |
| Exact Mass | 283.07 |
| IUPAC Name | 2-(1,3,7-trimethyl-2,6-dioxopurin-8-yl)sulfanylacetamide |
| SMILES | Cn1c(=O)c2c(nc(SCC(N)=O)n2C)n(C)c1=O |
| InChI | InChI=1S/C10H13N5O3S/c1-13-6-7(12-9(13)19-4-5(11)16)14(2)10(18)15(3)8(6)17/h4H2,1-3H3,(H2,11,16) |
| InChIKey | OIFLXPXGEYVMCL-UHFFFAOYSA-N |
| XLogP | -1.45 |
| TPSA | 104.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.31 |
| LogP ≤ 5 | -1.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |