C11H18ClN5O2S — CID 131700942
8-(3-aminopropylsulfanyl)-1,3,7-trimethylpurine-2,6-dione;hydrochloride (PubChem CID 131700942) has the molecular formula C11H18ClN5O2S and a molecular weight of 319.82 g/mol. Its IUPAC name is 8-(3-aminopropylsulfanyl)-1,3,7-trimethylpurine-2,6-dione;hydrochloride.
| Compound Name | 8-(3-aminopropylsulfanyl)-1,3,7-trimethylpurine-2,6-dione;hydrochloride |
|---|---|
| PubChem CID | 131700942 |
| Molecular Formula | C11H18ClN5O2S |
| Molecular Weight | 319.82 g/mol |
| Exact Mass | 319.09 |
| IUPAC Name | 8-(3-aminopropylsulfanyl)-1,3,7-trimethylpurine-2,6-dione;hydrochloride |
| SMILES | Cl.Cn1c(=O)c2c(nc(SCCCN)n2C)n(C)c1=O |
| InChI | InChI=1S/C11H17N5O2S.ClH/c1-14-7-8(13-10(14)19-6-4-5-12)15(2)11(18)16(3)9(7)17;/h4-6,12H2,1-3H3;1H |
| InChIKey | RVVCOIMRDPWDGY-UHFFFAOYSA-N |
| XLogP | -0.17 |
| TPSA | 87.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.82 |
| LogP ≤ 5 | -0.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|