C10H15N5O2S — CID 22994
8-(2-aminoethylsulfanyl)-1,3,7-trimethylpurine-2,6-dione (PubChem CID 22994) has the molecular formula C10H15N5O2S and a molecular weight of 269.33 g/mol. Its IUPAC name is 8-(2-aminoethylsulfanyl)-1,3,7-trimethylpurine-2,6-dione.
| Compound Name | 8-(2-aminoethylsulfanyl)-1,3,7-trimethylpurine-2,6-dione |
|---|---|
| PubChem CID | 22994 |
| Molecular Formula | C10H15N5O2S |
| Molecular Weight | 269.33 g/mol |
| Exact Mass | 269.09 |
| IUPAC Name | 8-(2-aminoethylsulfanyl)-1,3,7-trimethylpurine-2,6-dione |
| SMILES | Cn1c(=O)c2c(nc(SCCN)n2C)n(C)c1=O |
| InChI | InChI=1S/C10H15N5O2S/c1-13-6-7(12-9(13)18-5-4-11)14(2)10(17)15(3)8(6)16/h4-5,11H2,1-3H3 |
| InChIKey | FUOYEJAXPJNZTJ-UHFFFAOYSA-N |
| XLogP | -0.98 |
| TPSA | 87.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.33 |
| LogP ≤ 5 | -0.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |