C19H19N5O2S — CID 7519581
2-[6-(4-imidazol-1-ylphenyl)pyridazin-3-yl]sulfanyl-1-morpholin-4-ylethanone (PubChem CID 7519581) has the molecular formula C19H19N5O2S and a molecular weight of 381.46 g/mol. Its IUPAC name is 2-[6-(4-imidazol-1-ylphenyl)pyridazin-3-yl]sulfanyl-1-morpholin-4-ylethanone.
| Compound Name | 2-[6-(4-imidazol-1-ylphenyl)pyridazin-3-yl]sulfanyl-1-morpholin-4-ylethanone |
|---|---|
| PubChem CID | 7519581 |
| Molecular Formula | C19H19N5O2S |
| Molecular Weight | 381.46 g/mol |
| Exact Mass | 381.13 |
| IUPAC Name | 2-[6-(4-imidazol-1-ylphenyl)pyridazin-3-yl]sulfanyl-1-morpholin-4-ylethanone |
| SMILES | O=C(CSc1ccc(-c2ccc(-n3ccnc3)cc2)nn1)N1CCOCC1 |
| InChI | InChI=1S/C19H19N5O2S/c25-19(23-9-11-26-12-10-23)13-27-18-6-5-17(21-22-18)15-1-3-16(4-2-15)24-8-7-20-14-24/h1-8,14H,9-13H2 |
| InChIKey | RHLLBOIPNOELBD-UHFFFAOYSA-N |
| XLogP | 2.28 |
| TPSA | 73.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.46 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |