C16H12N4O4 — CID 5297849
[4-[(2-methyl-5-nitro-1,2,4-triazol-3-yl)oxy]phenyl]-phenylmethanone (PubChem CID 5297849) has the molecular formula C16H12N4O4 and a molecular weight of 324.30 g/mol. Its IUPAC name is [4-[(2-methyl-5-nitro-1,2,4-triazol-3-yl)oxy]phenyl]-phenylmethanone.
| Compound Name | [4-[(2-methyl-5-nitro-1,2,4-triazol-3-yl)oxy]phenyl]-phenylmethanone |
|---|---|
| PubChem CID | 5297849 |
| Molecular Formula | C16H12N4O4 |
| Molecular Weight | 324.30 g/mol |
| Exact Mass | 324.09 |
| IUPAC Name | [4-[(2-methyl-5-nitro-1,2,4-triazol-3-yl)oxy]phenyl]-phenylmethanone |
| SMILES | Cn1nc([N+](=O)[O-])nc1Oc1ccc(C(=O)c2ccccc2)cc1 |
| InChI | InChI=1S/C16H12N4O4/c1-19-16(17-15(18-19)20(22)23)24-13-9-7-12(8-10-13)14(21)11-5-3-2-4-6-11/h2-10H,1H3 |
| InChIKey | JNICPHYRPBDQGH-UHFFFAOYSA-N |
| XLogP | 2.75 |
| TPSA | 100.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.30 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|