About [4-[(2-methyl-5-nitro-1,2,4-triazol-3-yl)oxy]phenyl]-phenylmethanone
[4-[(2-methyl-5-nitro-1,2,4-triazol-3-yl)oxy]phenyl]-phenylmethanone (PubChem CID 5297849) has the molecular formula C16H12N4O4
and a molecular weight of 324.30 g/mol. Its IUPAC name is [4-[(2-methyl-5-nitro-1,2,4-triazol-3-yl)oxy]phenyl]-phenylmethanone.
Molecular Properties
| Compound Name | [4-[(2-methyl-5-nitro-1,2,4-triazol-3-yl)oxy]phenyl]-phenylmethanone |
| PubChem CID | 5297849 |
| Molecular Formula | C16H12N4O4 |
| Molecular Weight | 324.30 g/mol |
| Exact Mass | 324.09 |
| IUPAC Name | [4-[(2-methyl-5-nitro-1,2,4-triazol-3-yl)oxy]phenyl]-phenylmethanone |
| SMILES | Cn1nc([N+](=O)[O-])nc1Oc1ccc(C(=O)c2ccccc2)cc1 |
| InChI | InChI=1S/C16H12N4O4/c1-19-16(17-15(18-19)20(22)23)24-13-9-7-12(8-10-13)14(21)11-5-3-2-4-6-11/h2-10H,1H3 |
| InChIKey | JNICPHYRPBDQGH-UHFFFAOYSA-N |
| XLogP | 2.75 |
| TPSA | 100.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 324.30 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze [4-[(2-methyl-5-nitro-1,2,4-triazol-3-yl)oxy]phenyl]-phenylmethanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [4-[(2-methyl-5-nitro-1,2,4-triazol-3-yl)oxy]phenyl]-phenylmethanone?
The IUPAC name of [4-[(2-methyl-5-nitro-1,2,4-triazol-3-yl)oxy]phenyl]-phenylmethanone (CID 5297849) is [4-[(2-methyl-5-nitro-1,2,4-triazol-3-yl)oxy]phenyl]-phenylmethanone.
What is the SMILES notation for [4-[(2-methyl-5-nitro-1,2,4-triazol-3-yl)oxy]phenyl]-phenylmethanone?
The canonical SMILES for [4-[(2-methyl-5-nitro-1,2,4-triazol-3-yl)oxy]phenyl]-phenylmethanone is Cn1nc([N+](=O)[O-])nc1Oc1ccc(C(=O)c2ccccc2)cc1.
What is the InChIKey of [4-[(2-methyl-5-nitro-1,2,4-triazol-3-yl)oxy]phenyl]-phenylmethanone?
The InChIKey is JNICPHYRPBDQGH-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H12N4O4/c1-19-16(17-15(18-19)20(22)23)24-13-9-7-12(8-10-13)14(21)11-5-3-2-4-6-11/h2-10H,1H3.
What are the key properties of [4-[(2-methyl-5-nitro-1,2,4-triazol-3-yl)oxy]phenyl]-phenylmethanone?
[4-[(2-methyl-5-nitro-1,2,4-triazol-3-yl)oxy]phenyl]-phenylmethanone has a molecular weight of 324.30 g/mol, XLogP of 2.75, 5 rotatable bonds, 0 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for [4-[(2-methyl-5-nitro-1,2,4-triazol-3-yl)oxy]phenyl]-phenylmethanone is sourced from PubChem (CID 5297849), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).