C16H11N3O4S — CID 11393673
5-(4-nitrophenyl)-7,9-dihydro-[1,3]dioxolo[4,5-h][2,3]benzodiazepine-8-thione (PubChem CID 11393673) has the molecular formula C16H11N3O4S and a molecular weight of 341.35 g/mol. Its IUPAC name is 5-(4-nitrophenyl)-7,9-dihydro-[1,3]dioxolo[4,5-h][2,3]benzodiazepine-8-thione.
| Compound Name | 5-(4-nitrophenyl)-7,9-dihydro-[1,3]dioxolo[4,5-h][2,3]benzodiazepine-8-thione |
|---|---|
| PubChem CID | 11393673 |
| Molecular Formula | C16H11N3O4S |
| Molecular Weight | 341.35 g/mol |
| Exact Mass | 341.05 |
| IUPAC Name | 5-(4-nitrophenyl)-7,9-dihydro-[1,3]dioxolo[4,5-h][2,3]benzodiazepine-8-thione |
| SMILES | O=[N+]([O-])c1ccc(C2=NNC(=S)Cc3cc4c(cc32)OCO4)cc1 |
| InChI | InChI=1S/C16H11N3O4S/c20-19(21)11-3-1-9(2-4-11)16-12-7-14-13(22-8-23-14)5-10(12)6-15(24)17-18-16/h1-5,7H,6,8H2,(H,17,24) |
| InChIKey | QDWYKLFYOQCUIU-UHFFFAOYSA-N |
| XLogP | 2.55 |
| TPSA | 85.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.35 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|