C19H17N5O5S — CID 87833199
N-[[(8R)-8-methyl-5-(4-nitrophenyl)-8,9-dihydro-[1,3]dioxolo[4,5-h][2,3]benzodiazepine-7-carbothioyl]amino]formamide (PubChem CID 87833199) has the molecular formula C19H17N5O5S and a molecular weight of 427.44 g/mol. Its IUPAC name is N-[[(8R)-8-methyl-5-(4-nitrophenyl)-8,9-dihydro-[1,3]dioxolo[4,5-h][2,3]benzodiazepine-7-carbothioyl]amino]formamide.
| Compound Name | N-[[(8R)-8-methyl-5-(4-nitrophenyl)-8,9-dihydro-[1,3]dioxolo[4,5-h][2,3]benzodiazepine-7-carbothioyl]amino]formamide |
|---|---|
| PubChem CID | 87833199 |
| Molecular Formula | C19H17N5O5S |
| Molecular Weight | 427.44 g/mol |
| Exact Mass | 427.10 |
| IUPAC Name | N-[[(8R)-8-methyl-5-(4-nitrophenyl)-8,9-dihydro-[1,3]dioxolo[4,5-h][2,3]benzodiazepine-7-carbothioyl]amino]formamide |
| SMILES | C[C@@H]1Cc2cc3c(cc2C(c2ccc([N+](=O)[O-])cc2)=NN1C(=S)NNC=O)OCO3 |
| InChI | InChI=1S/C19H17N5O5S/c1-11-6-13-7-16-17(29-10-28-16)8-15(13)18(22-23(11)19(30)21-20-9-25)12-2-4-14(5-3-12)24(26)27/h2-5,7-9,11H,6,10H2,1H3,(H,20,25)(H,21,30)/t11-/m1/s1 |
| InChIKey | OLZJAJLZNJEBKY-LLVKDONJSA-N |
| XLogP | 1.86 |
| TPSA | 118.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.44 |
| LogP ≤ 5 | 1.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|