C19H14F3N3O5 — CID 19040689
2,2,2-trifluoro-1-[8-methyl-5-(4-nitrophenyl)-8,9-dihydro-3H-dioxolo[3,4-h][2,3]benzodiazepin-7-yl]ethanone (PubChem CID 19040689) has the molecular formula C19H14F3N3O5 and a molecular weight of 421.33 g/mol. Its IUPAC name is 2,2,2-trifluoro-1-[8-methyl-5-(4-nitrophenyl)-8,9-dihydro-3H-dioxolo[3,4-h][2,3]benzodiazepin-7-yl]ethanone.
| Compound Name | 2,2,2-trifluoro-1-[8-methyl-5-(4-nitrophenyl)-8,9-dihydro-3H-dioxolo[3,4-h][2,3]benzodiazepin-7-yl]ethanone |
|---|---|
| PubChem CID | 19040689 |
| Molecular Formula | C19H14F3N3O5 |
| Molecular Weight | 421.33 g/mol |
| Exact Mass | 421.09 |
| IUPAC Name | 2,2,2-trifluoro-1-[8-methyl-5-(4-nitrophenyl)-8,9-dihydro-3H-dioxolo[3,4-h][2,3]benzodiazepin-7-yl]ethanone |
| SMILES | CC1Cc2cc3c(cc2C(c2ccc([N+](=O)[O-])cc2)=NN1C(=O)C(F)(F)F)COO3 |
| InChI | InChI=1S/C19H14F3N3O5/c1-10-6-12-8-16-13(9-29-30-16)7-15(12)17(23-24(10)18(26)19(20,21)22)11-2-4-14(5-3-11)25(27)28/h2-5,7-8,10H,6,9H2,1H3 |
| InChIKey | VDWJRPIDBSIPHH-UHFFFAOYSA-N |
| XLogP | 3.51 |
| TPSA | 94.27 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.33 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|