C18H10F3N5O4 — CID 21350771
9-(4-nitrophenyl)-6-(trifluoromethyl)-13,15-dioxa-4,5,7,8-tetrazatetracyclo[8.7.0.03,7.012,16]heptadeca-1(17),3,5,8,10,12(16)-hexaene (PubChem CID 21350771) has the molecular formula C18H10F3N5O4 and a molecular weight of 417.30 g/mol. Its IUPAC name is 9-(4-nitrophenyl)-6-(trifluoromethyl)-13,15-dioxa-4,5,7,8-tetrazatetracyclo[8.7.0.03,7.012,16]heptadeca-1(17),3,5,8,10,12(16)-hexaene.
| Compound Name | 9-(4-nitrophenyl)-6-(trifluoromethyl)-13,15-dioxa-4,5,7,8-tetrazatetracyclo[8.7.0.03,7.012,16]heptadeca-1(17),3,5,8,10,12(16)-hexaene |
|---|---|
| PubChem CID | 21350771 |
| Molecular Formula | C18H10F3N5O4 |
| Molecular Weight | 417.30 g/mol |
| Exact Mass | 417.07 |
| IUPAC Name | 9-(4-nitrophenyl)-6-(trifluoromethyl)-13,15-dioxa-4,5,7,8-tetrazatetracyclo[8.7.0.03,7.012,16]heptadeca-1(17),3,5,8,10,12(16)-hexaene |
| SMILES | O=[N+]([O-])c1ccc(C2=Nn3c(nnc3C(F)(F)F)Cc3cc4c(cc32)OCO4)cc1 |
| InChI | InChI=1S/C18H10F3N5O4/c19-18(20,21)17-23-22-15-6-10-5-13-14(30-8-29-13)7-12(10)16(24-25(15)17)9-1-3-11(4-2-9)26(27)28/h1-5,7H,6,8H2 |
| InChIKey | QUBVWCDLARDHAU-UHFFFAOYSA-N |
| XLogP | 3.14 |
| TPSA | 104.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.30 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|