C21H19N5O6 — CID 11732859
ethyl 8,9-dimethoxy-6-(4-nitrophenyl)-11H-[1,2,4]triazolo[4,3-c][2,3]benzodiazepine-3-carboxylate (PubChem CID 11732859) has the molecular formula C21H19N5O6 and a molecular weight of 437.41 g/mol. Its IUPAC name is ethyl 8,9-dimethoxy-6-(4-nitrophenyl)-11H-[1,2,4]triazolo[4,3-c][2,3]benzodiazepine-3-carboxylate.
| Compound Name | ethyl 8,9-dimethoxy-6-(4-nitrophenyl)-11H-[1,2,4]triazolo[4,3-c][2,3]benzodiazepine-3-carboxylate |
|---|---|
| PubChem CID | 11732859 |
| Molecular Formula | C21H19N5O6 |
| Molecular Weight | 437.41 g/mol |
| Exact Mass | 437.13 |
| IUPAC Name | ethyl 8,9-dimethoxy-6-(4-nitrophenyl)-11H-[1,2,4]triazolo[4,3-c][2,3]benzodiazepine-3-carboxylate |
| SMILES | CCOC(=O)c1nnc2n1N=C(c1ccc([N+](=O)[O-])cc1)c1cc(OC)c(OC)cc1C2 |
| InChI | InChI=1S/C21H19N5O6/c1-4-32-21(27)20-23-22-18-10-13-9-16(30-2)17(31-3)11-15(13)19(24-25(18)20)12-5-7-14(8-6-12)26(28)29/h5-9,11H,4,10H2,1-3H3 |
| InChIKey | VLAQXCJKDLBMKP-UHFFFAOYSA-N |
| XLogP | 2.59 |
| TPSA | 130.97 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.41 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|