C23H22N4O4 — CID 69275333
7,8-dimethoxy-4-methyl-1-(4-nitrophenyl)-3-pyridin-2-yl-4,5-dihydro-2,3-benzodiazepine (PubChem CID 69275333) has the molecular formula C23H22N4O4 and a molecular weight of 418.45 g/mol. Its IUPAC name is 7,8-dimethoxy-4-methyl-1-(4-nitrophenyl)-3-pyridin-2-yl-4,5-dihydro-2,3-benzodiazepine.
| Compound Name | 7,8-dimethoxy-4-methyl-1-(4-nitrophenyl)-3-pyridin-2-yl-4,5-dihydro-2,3-benzodiazepine |
|---|---|
| PubChem CID | 69275333 |
| Molecular Formula | C23H22N4O4 |
| Molecular Weight | 418.45 g/mol |
| Exact Mass | 418.16 |
| IUPAC Name | 7,8-dimethoxy-4-methyl-1-(4-nitrophenyl)-3-pyridin-2-yl-4,5-dihydro-2,3-benzodiazepine |
| SMILES | COc1cc2c(cc1OC)C(c1ccc([N+](=O)[O-])cc1)=NN(c1ccccn1)C(C)C2 |
| InChI | InChI=1S/C23H22N4O4/c1-15-12-17-13-20(30-2)21(31-3)14-19(17)23(16-7-9-18(10-8-16)27(28)29)25-26(15)22-6-4-5-11-24-22/h4-11,13-15H,12H2,1-3H3 |
| InChIKey | ORHZCIFAJJZILT-UHFFFAOYSA-N |
| XLogP | 4.21 |
| TPSA | 90.09 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.45 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|