C21H21N5O5S — CID 69276651
2-[(4R)-7,8-dimethoxy-4-methyl-1-(4-nitrophenyl)-4,5-dihydro-2,3-benzodiazepin-3-yl]-4H-1,3,4-thiadiazin-5-one (PubChem CID 69276651) has the molecular formula C21H21N5O5S and a molecular weight of 455.50 g/mol. Its IUPAC name is 2-[(4R)-7,8-dimethoxy-4-methyl-1-(4-nitrophenyl)-4,5-dihydro-2,3-benzodiazepin-3-yl]-4H-1,3,4-thiadiazin-5-one.
| Compound Name | 2-[(4R)-7,8-dimethoxy-4-methyl-1-(4-nitrophenyl)-4,5-dihydro-2,3-benzodiazepin-3-yl]-4H-1,3,4-thiadiazin-5-one |
|---|---|
| PubChem CID | 69276651 |
| Molecular Formula | C21H21N5O5S |
| Molecular Weight | 455.50 g/mol |
| Exact Mass | 455.13 |
| IUPAC Name | 2-[(4R)-7,8-dimethoxy-4-methyl-1-(4-nitrophenyl)-4,5-dihydro-2,3-benzodiazepin-3-yl]-4H-1,3,4-thiadiazin-5-one |
| SMILES | COc1cc2c(cc1OC)C(c1ccc([N+](=O)[O-])cc1)=NN(C1=NNC(=O)CS1)[C@H](C)C2 |
| InChI | InChI=1S/C21H21N5O5S/c1-12-8-14-9-17(30-2)18(31-3)10-16(14)20(13-4-6-15(7-5-13)26(28)29)24-25(12)21-23-22-19(27)11-32-21/h4-7,9-10,12H,8,11H2,1-3H3,(H,22,27)/t12-/m1/s1 |
| InChIKey | TWUQGJCRXXSMLV-GFCCVEGCSA-N |
| XLogP | 2.74 |
| TPSA | 118.66 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.50 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|