C15H14N4O6 — CID 100785584
ethyl 2-(2-amino-2-oxoethyl)-6-(4-nitrophenyl)-3-oxopyridazine-4-carboxylate (PubChem CID 100785584) has the molecular formula C15H14N4O6 and a molecular weight of 346.30 g/mol. Its IUPAC name is ethyl 2-(2-amino-2-oxoethyl)-6-(4-nitrophenyl)-3-oxopyridazine-4-carboxylate.
| Compound Name | ethyl 2-(2-amino-2-oxoethyl)-6-(4-nitrophenyl)-3-oxopyridazine-4-carboxylate |
|---|---|
| PubChem CID | 100785584 |
| Molecular Formula | C15H14N4O6 |
| Molecular Weight | 346.30 g/mol |
| Exact Mass | 346.09 |
| IUPAC Name | ethyl 2-(2-amino-2-oxoethyl)-6-(4-nitrophenyl)-3-oxopyridazine-4-carboxylate |
| SMILES | CCOC(=O)c1cc(-c2ccc([N+](=O)[O-])cc2)nn(CC(N)=O)c1=O |
| InChI | InChI=1S/C15H14N4O6/c1-2-25-15(22)11-7-12(17-18(14(11)21)8-13(16)20)9-3-5-10(6-4-9)19(23)24/h3-7H,2,8H2,1H3,(H2,16,20) |
| InChIKey | CZTZWQKUSQCWRW-UHFFFAOYSA-N |
| XLogP | 0.48 |
| TPSA | 147.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.30 |
| LogP ≤ 5 | 0.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|