C19H13Br2NO4 — CID 71507880
ethyl 5,8-dibromo-3-(4-nitrophenyl)naphthalene-2-carboxylate (PubChem CID 71507880) has the molecular formula C19H13Br2NO4 and a molecular weight of 479.12 g/mol. Its IUPAC name is ethyl 5,8-dibromo-3-(4-nitrophenyl)naphthalene-2-carboxylate.
| Compound Name | ethyl 5,8-dibromo-3-(4-nitrophenyl)naphthalene-2-carboxylate |
|---|---|
| PubChem CID | 71507880 |
| Molecular Formula | C19H13Br2NO4 |
| Molecular Weight | 479.12 g/mol |
| Exact Mass | 476.92 |
| IUPAC Name | ethyl 5,8-dibromo-3-(4-nitrophenyl)naphthalene-2-carboxylate |
| SMILES | CCOC(=O)c1cc2c(Br)ccc(Br)c2cc1-c1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C19H13Br2NO4/c1-2-26-19(23)16-10-15-14(17(20)7-8-18(15)21)9-13(16)11-3-5-12(6-4-11)22(24)25/h3-10H,2H2,1H3 |
| InChIKey | LSZVGIQVAYTYPT-UHFFFAOYSA-N |
| XLogP | 6.12 |
| TPSA | 69.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.12 |
| LogP ≤ 5 | 6.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|