C34H26BrN3O6 — CID 46898005
16,17-dimethoxy-21-[2-(5-nitro-1H-indol-2-yl)phenyl]-5,7-dioxa-13-azoniapentacyclo[11.8.0.02,10.04,8.015,20]henicosa-1(13),2,4(8),9,14,16,18,20-octaene bromide (PubChem CID 46898005) has the molecular formula C34H26BrN3O6 and a molecular weight of 652.50 g/mol. Its IUPAC name is 16,17-dimethoxy-21-[2-(5-nitro-1H-indol-2-yl)phenyl]-5,7-dioxa-13-azoniapentacyclo[11.8.0.02,10.04,8.015,20]henicosa-1(13),2,4(8),9,14,16,18,20-octaene bromide.
| Compound Name | 16,17-dimethoxy-21-[2-(5-nitro-1H-indol-2-yl)phenyl]-5,7-dioxa-13-azoniapentacyclo[11.8.0.02,10.04,8.015,20]henicosa-1(13),2,4(8),9,14,16,18,20-octaene bromide |
|---|---|
| PubChem CID | 46898005 |
| Molecular Formula | C34H26BrN3O6 |
| Molecular Weight | 652.50 g/mol |
| Exact Mass | 651.10 |
| IUPAC Name | 16,17-dimethoxy-21-[2-(5-nitro-1H-indol-2-yl)phenyl]-5,7-dioxa-13-azoniapentacyclo[11.8.0.02,10.04,8.015,20]henicosa-1(13),2,4(8),9,14,16,18,20-octaene bromide |
| SMILES | COc1ccc2c(-c3ccccc3-c3cc4cc([N+](=O)[O-])ccc4[nH]3)c3[n+](cc2c1OC)CCc1cc2c(cc1-3)OCO2.[Br-] |
| InChI | InChI=1S/C34H26N3O6.BrH/c1-40-29-10-8-24-26(34(29)41-2)17-36-12-11-19-15-30-31(43-18-42-30)16-25(19)33(36)32(24)23-6-4-3-5-22(23)28-14-20-13-21(37(38)39)7-9-27(20)35-28;/h3-10,13-17,35H,11-12,18H2,1-2H3;1H/q+1;/p-1 |
| InChIKey | PQOIQAQOEMTDRH-UHFFFAOYSA-M |
| XLogP | 3.82 |
| TPSA | 99.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 44 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 652.50 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|