C25H26N+ — CID 166054743
1-(4-tert-butyl-1-methylnaphthalen-2-yl)-2-methylisoquinolin-2-ium (PubChem CID 166054743) has the molecular formula C25H26N+ and a molecular weight of 340.49 g/mol. Its IUPAC name is 1-(4-tert-butyl-1-methylnaphthalen-2-yl)-2-methylisoquinolin-2-ium.
| Compound Name | 1-(4-tert-butyl-1-methylnaphthalen-2-yl)-2-methylisoquinolin-2-ium |
|---|---|
| PubChem CID | 166054743 |
| Molecular Formula | C25H26N+ |
| Molecular Weight | 340.49 g/mol |
| Exact Mass | 340.21 |
| IUPAC Name | 1-(4-tert-butyl-1-methylnaphthalen-2-yl)-2-methylisoquinolin-2-ium |
| SMILES | Cc1c(-c2c3ccccc3cc[n+]2C)cc(C(C)(C)C)c2ccccc12 |
| InChI | InChI=1S/C25H26N/c1-17-19-11-8-9-13-21(19)23(25(2,3)4)16-22(17)24-20-12-7-6-10-18(20)14-15-26(24)5/h6-16H,1-5H3/q+1 |
| InChIKey | ZPTRKYADQVNDOA-UHFFFAOYSA-N |
| XLogP | 6.09 |
| TPSA | 3.88 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.49 |
| LogP ≤ 5 | 6.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|