C33H37N2+ — CID 156667184
1-(4-tert-butyl-1-methylnaphthalen-2-yl)-8-(2,2-dimethylpropyl)-2-methyl-2,7-phenanthrolin-2-ium (PubChem CID 156667184) has the molecular formula C33H37N2+ and a molecular weight of 461.67 g/mol. Its IUPAC name is 1-(4-tert-butyl-1-methylnaphthalen-2-yl)-8-(2,2-dimethylpropyl)-2-methyl-2,7-phenanthrolin-2-ium.
| Compound Name | 1-(4-tert-butyl-1-methylnaphthalen-2-yl)-8-(2,2-dimethylpropyl)-2-methyl-2,7-phenanthrolin-2-ium |
|---|---|
| PubChem CID | 156667184 |
| Molecular Formula | C33H37N2+ |
| Molecular Weight | 461.67 g/mol |
| Exact Mass | 461.30 |
| IUPAC Name | 1-(4-tert-butyl-1-methylnaphthalen-2-yl)-8-(2,2-dimethylpropyl)-2-methyl-2,7-phenanthrolin-2-ium |
| SMILES | Cc1c(-c2c3c(ccc4nc(CC(C)(C)C)ccc43)cc[n+]2C)cc(C(C)(C)C)c2ccccc12 |
| InChI | InChI=1S/C33H37N2/c1-21-24-11-9-10-12-25(24)28(33(5,6)7)19-27(21)31-30-22(17-18-35(31)8)13-16-29-26(30)15-14-23(34-29)20-32(2,3)4/h9-19H,20H2,1-8H3/q+1 |
| InChIKey | HTBADVVTIKVASE-UHFFFAOYSA-N |
| XLogP | 8.23 |
| TPSA | 16.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.67 |
| LogP ≤ 5 | 8.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|