C29H26F3N2+ — CID 165160783
4-(4-tert-butyl-1-methylnaphthalen-2-yl)-3-methyl-10-(trifluoromethyl)benzo[g]quinazolin-3-ium (PubChem CID 165160783) has the molecular formula C29H26F3N2+ and a molecular weight of 459.54 g/mol. Its IUPAC name is 4-(4-tert-butyl-1-methylnaphthalen-2-yl)-3-methyl-10-(trifluoromethyl)benzo[g]quinazolin-3-ium.
| Compound Name | 4-(4-tert-butyl-1-methylnaphthalen-2-yl)-3-methyl-10-(trifluoromethyl)benzo[g]quinazolin-3-ium |
|---|---|
| PubChem CID | 165160783 |
| Molecular Formula | C29H26F3N2+ |
| Molecular Weight | 459.54 g/mol |
| Exact Mass | 459.20 |
| IUPAC Name | 4-(4-tert-butyl-1-methylnaphthalen-2-yl)-3-methyl-10-(trifluoromethyl)benzo[g]quinazolin-3-ium |
| SMILES | Cc1c(-c2c3cc4ccccc4c(C(F)(F)F)c3nc[n+]2C)cc(C(C)(C)C)c2ccccc12 |
| InChI | InChI=1S/C29H26F3N2/c1-17-19-11-8-9-13-21(19)24(28(2,3)4)15-22(17)27-23-14-18-10-6-7-12-20(18)25(29(30,31)32)26(23)33-16-34(27)5/h6-16H,1-5H3/q+1 |
| InChIKey | NRAWPZQGMKFPRO-UHFFFAOYSA-N |
| XLogP | 7.66 |
| TPSA | 16.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.54 |
| LogP ≤ 5 | 7.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|