C29H21F3N2S — CID 163546313
4-(8-tert-butylbenzo[f][1]benzothiol-6-yl)-10-(trifluoromethyl)benzo[g]quinazoline (PubChem CID 163546313) has the molecular formula C29H21F3N2S and a molecular weight of 486.56 g/mol. Its IUPAC name is 4-(8-tert-butylbenzo[f][1]benzothiol-6-yl)-10-(trifluoromethyl)benzo[g]quinazoline.
| Compound Name | 4-(8-tert-butylbenzo[f][1]benzothiol-6-yl)-10-(trifluoromethyl)benzo[g]quinazoline |
|---|---|
| PubChem CID | 163546313 |
| Molecular Formula | C29H21F3N2S |
| Molecular Weight | 486.56 g/mol |
| Exact Mass | 486.14 |
| IUPAC Name | 4-(8-tert-butylbenzo[f][1]benzothiol-6-yl)-10-(trifluoromethyl)benzo[g]quinazoline |
| SMILES | CC(C)(C)c1cc(-c2ncnc3c(C(F)(F)F)c4ccccc4cc23)cc2cc3ccsc3cc12 |
| InChI | InChI=1S/C29H21F3N2S/c1-28(2,3)23-13-19(11-18-10-17-8-9-35-24(17)14-21(18)23)26-22-12-16-6-4-5-7-20(16)25(29(30,31)32)27(22)34-15-33-26/h4-15H,1-3H3 |
| InChIKey | FCKYXROIFFLVGL-UHFFFAOYSA-N |
| XLogP | 9.13 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.56 |
| LogP ≤ 5 | 9.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|