C30H23F3N2S — CID 163446084
1-(5-tert-butylbenzo[f][1]benzothiol-7-yl)-4-methyl-5-(trifluoromethyl)benzo[g]phthalazine (PubChem CID 163446084) has the molecular formula C30H23F3N2S and a molecular weight of 500.59 g/mol. Its IUPAC name is 1-(5-tert-butylbenzo[f][1]benzothiol-7-yl)-4-methyl-5-(trifluoromethyl)benzo[g]phthalazine.
| Compound Name | 1-(5-tert-butylbenzo[f][1]benzothiol-7-yl)-4-methyl-5-(trifluoromethyl)benzo[g]phthalazine |
|---|---|
| PubChem CID | 163446084 |
| Molecular Formula | C30H23F3N2S |
| Molecular Weight | 500.59 g/mol |
| Exact Mass | 500.15 |
| IUPAC Name | 1-(5-tert-butylbenzo[f][1]benzothiol-7-yl)-4-methyl-5-(trifluoromethyl)benzo[g]phthalazine |
| SMILES | Cc1nnc(-c2cc(C(C)(C)C)c3cc4ccsc4cc3c2)c2cc3ccccc3c(C(F)(F)F)c12 |
| InChI | InChI=1S/C30H23F3N2S/c1-16-26-23(12-17-7-5-6-8-21(17)27(26)30(31,32)33)28(35-34-16)20-11-19-15-25-18(9-10-36-25)13-22(19)24(14-20)29(2,3)4/h5-15H,1-4H3 |
| InChIKey | BNNQKHIERDUSLB-UHFFFAOYSA-N |
| XLogP | 9.44 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 500.59 |
| LogP ≤ 5 | 9.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|