C27H25NO — CID 166570041
4-(4-tert-butylnaphthalen-2-yl)-2,3-dimethylfuro[3,2-c]quinoline (PubChem CID 166570041) has the molecular formula C27H25NO and a molecular weight of 379.50 g/mol. Its IUPAC name is 4-(4-tert-butylnaphthalen-2-yl)-2,3-dimethylfuro[3,2-c]quinoline.
| Compound Name | 4-(4-tert-butylnaphthalen-2-yl)-2,3-dimethylfuro[3,2-c]quinoline |
|---|---|
| PubChem CID | 166570041 |
| Molecular Formula | C27H25NO |
| Molecular Weight | 379.50 g/mol |
| Exact Mass | 379.19 |
| IUPAC Name | 4-(4-tert-butylnaphthalen-2-yl)-2,3-dimethylfuro[3,2-c]quinoline |
| SMILES | Cc1oc2c(c(-c3cc(C(C)(C)C)c4ccccc4c3)nc3ccccc32)c1C |
| InChI | InChI=1S/C27H25NO/c1-16-17(2)29-26-21-12-8-9-13-23(21)28-25(24(16)26)19-14-18-10-6-7-11-20(18)22(15-19)27(3,4)5/h6-15H,1-5H3 |
| InChIKey | UGDRCSFBBCVQCG-UHFFFAOYSA-N |
| XLogP | 7.72 |
| TPSA | 26.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.50 |
| LogP ≤ 5 | 7.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |