C35H33NSSi — CID 170566810
[7-(4-tert-butylnaphthalen-2-yl)-3-methylthieno[2,3-c]pyridin-2-yl]-methyl-diphenylsilane (PubChem CID 170566810) has the molecular formula C35H33NSSi and a molecular weight of 527.81 g/mol. Its IUPAC name is [7-(4-tert-butylnaphthalen-2-yl)-3-methylthieno[2,3-c]pyridin-2-yl]-methyl-diphenylsilane.
| Compound Name | [7-(4-tert-butylnaphthalen-2-yl)-3-methylthieno[2,3-c]pyridin-2-yl]-methyl-diphenylsilane |
|---|---|
| PubChem CID | 170566810 |
| Molecular Formula | C35H33NSSi |
| Molecular Weight | 527.81 g/mol |
| Exact Mass | 527.21 |
| IUPAC Name | [7-(4-tert-butylnaphthalen-2-yl)-3-methylthieno[2,3-c]pyridin-2-yl]-methyl-diphenylsilane |
| SMILES | Cc1c([Si](C)(c2ccccc2)c2ccccc2)sc2c(-c3cc(C(C)(C)C)c4ccccc4c3)nccc12 |
| InChI | InChI=1S/C35H33NSSi/c1-24-29-20-21-36-32(26-22-25-14-12-13-19-30(25)31(23-26)35(2,3)4)33(29)37-34(24)38(5,27-15-8-6-9-16-27)28-17-10-7-11-18-28/h6-23H,1-5H3 |
| InChIKey | XSLHLASGYWCPRL-UHFFFAOYSA-N |
| XLogP | 7.82 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 527.81 |
| LogP ≤ 5 | 7.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|