C36H35NSSi — CID 170660272
[7-(4-tert-butylnaphthalen-2-yl)-3-methylthieno[2,3-c]pyridin-2-yl]-ethyl-diphenylsilane (PubChem CID 170660272) has the molecular formula C36H35NSSi and a molecular weight of 541.84 g/mol. Its IUPAC name is [7-(4-tert-butylnaphthalen-2-yl)-3-methylthieno[2,3-c]pyridin-2-yl]-ethyl-diphenylsilane.
| Compound Name | [7-(4-tert-butylnaphthalen-2-yl)-3-methylthieno[2,3-c]pyridin-2-yl]-ethyl-diphenylsilane |
|---|---|
| PubChem CID | 170660272 |
| Molecular Formula | C36H35NSSi |
| Molecular Weight | 541.84 g/mol |
| Exact Mass | 541.23 |
| IUPAC Name | [7-(4-tert-butylnaphthalen-2-yl)-3-methylthieno[2,3-c]pyridin-2-yl]-ethyl-diphenylsilane |
| SMILES | CC[Si](c1ccccc1)(c1ccccc1)c1sc2c(-c3cc(C(C)(C)C)c4ccccc4c3)nccc2c1C |
| InChI | InChI=1S/C36H35NSSi/c1-6-39(28-16-9-7-10-17-28,29-18-11-8-12-19-29)35-25(2)30-21-22-37-33(34(30)38-35)27-23-26-15-13-14-20-31(26)32(24-27)36(3,4)5/h7-24H,6H2,1-5H3 |
| InChIKey | ZEMHKEGGIPGKQN-UHFFFAOYSA-N |
| XLogP | 8.21 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 541.84 |
| LogP ≤ 5 | 8.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|