C34H45NSSi — CID 170660435
[7-(4-tert-butylnaphthalen-2-yl)-3-methylthieno[2,3-c]pyridin-2-yl]-cyclohexyl-di(propan-2-yl)silane (PubChem CID 170660435) has the molecular formula C34H45NSSi and a molecular weight of 527.89 g/mol. Its IUPAC name is [7-(4-tert-butylnaphthalen-2-yl)-3-methylthieno[2,3-c]pyridin-2-yl]-cyclohexyl-di(propan-2-yl)silane.
| Compound Name | [7-(4-tert-butylnaphthalen-2-yl)-3-methylthieno[2,3-c]pyridin-2-yl]-cyclohexyl-di(propan-2-yl)silane |
|---|---|
| PubChem CID | 170660435 |
| Molecular Formula | C34H45NSSi |
| Molecular Weight | 527.89 g/mol |
| Exact Mass | 527.30 |
| IUPAC Name | [7-(4-tert-butylnaphthalen-2-yl)-3-methylthieno[2,3-c]pyridin-2-yl]-cyclohexyl-di(propan-2-yl)silane |
| SMILES | Cc1c([Si](C(C)C)(C(C)C)C2CCCCC2)sc2c(-c3cc(C(C)(C)C)c4ccccc4c3)nccc12 |
| InChI | InChI=1S/C34H45NSSi/c1-22(2)37(23(3)4,27-15-10-9-11-16-27)33-24(5)28-18-19-35-31(32(28)36-33)26-20-25-14-12-13-17-29(25)30(21-26)34(6,7)8/h12-14,17-23,27H,9-11,15-16H2,1-8H3 |
| InChIKey | PXZIEGUXABVVHG-UHFFFAOYSA-N |
| XLogP | 10.53 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 527.89 |
| LogP ≤ 5 | 10.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|