C35H33F6NS — CID 169302104
1-(4-tert-butylnaphthalen-2-yl)-7-[4-(1,1,1,3,3,3-hexafluoropropan-2-yl)cyclohexyl]-8-methyl-[1]benzothiolo[2,3-c]pyridine (PubChem CID 169302104) has the molecular formula C35H33F6NS and a molecular weight of 613.71 g/mol. Its IUPAC name is 1-(4-tert-butylnaphthalen-2-yl)-7-[4-(1,1,1,3,3,3-hexafluoropropan-2-yl)cyclohexyl]-8-methyl-[1]benzothiolo[2,3-c]pyridine.
| Compound Name | 1-(4-tert-butylnaphthalen-2-yl)-7-[4-(1,1,1,3,3,3-hexafluoropropan-2-yl)cyclohexyl]-8-methyl-[1]benzothiolo[2,3-c]pyridine |
|---|---|
| PubChem CID | 169302104 |
| Molecular Formula | C35H33F6NS |
| Molecular Weight | 613.71 g/mol |
| Exact Mass | 613.22 |
| IUPAC Name | 1-(4-tert-butylnaphthalen-2-yl)-7-[4-(1,1,1,3,3,3-hexafluoropropan-2-yl)cyclohexyl]-8-methyl-[1]benzothiolo[2,3-c]pyridine |
| SMILES | Cc1c(C2CCC(C(C(F)(F)F)C(F)(F)F)CC2)ccc2c1sc1c(-c3cc(C(C)(C)C)c4ccccc4c3)nccc12 |
| InChI | InChI=1S/C35H33F6NS/c1-19-24(20-9-11-21(12-10-20)32(34(36,37)38)35(39,40)41)13-14-26-27-15-16-42-29(31(27)43-30(19)26)23-17-22-7-5-6-8-25(22)28(18-23)33(2,3)4/h5-8,13-18,20-21,32H,9-12H2,1-4H3 |
| InChIKey | KFBFXHQIEIFGTN-UHFFFAOYSA-N |
| XLogP | 11.89 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 613.71 |
| LogP ≤ 5 | 11.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |