C40H35NSSi — CID 170566811
[7-(4-tert-butylnaphthalen-2-yl)-3-methylthieno[2,3-c]pyridin-2-yl]-triphenylsilane (PubChem CID 170566811) has the molecular formula C40H35NSSi and a molecular weight of 589.88 g/mol. Its IUPAC name is [7-(4-tert-butylnaphthalen-2-yl)-3-methylthieno[2,3-c]pyridin-2-yl]-triphenylsilane.
| Compound Name | [7-(4-tert-butylnaphthalen-2-yl)-3-methylthieno[2,3-c]pyridin-2-yl]-triphenylsilane |
|---|---|
| PubChem CID | 170566811 |
| Molecular Formula | C40H35NSSi |
| Molecular Weight | 589.88 g/mol |
| Exact Mass | 589.23 |
| IUPAC Name | [7-(4-tert-butylnaphthalen-2-yl)-3-methylthieno[2,3-c]pyridin-2-yl]-triphenylsilane |
| SMILES | Cc1c([Si](c2ccccc2)(c2ccccc2)c2ccccc2)sc2c(-c3cc(C(C)(C)C)c4ccccc4c3)nccc12 |
| InChI | InChI=1S/C40H35NSSi/c1-28-34-24-25-41-37(30-26-29-16-14-15-23-35(29)36(27-30)40(2,3)4)38(34)42-39(28)43(31-17-8-5-9-18-31,32-19-10-6-11-20-32)33-21-12-7-13-22-33/h5-27H,1-4H3 |
| InChIKey | RAQQPCATWXZKEO-UHFFFAOYSA-N |
| XLogP | 8.10 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 589.88 |
| LogP ≤ 5 | 8.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|