C34H39NSSi — CID 163651391
[4-[7-(4-tert-butylnaphthalen-2-yl)-3-methylthieno[2,3-c]pyridin-2-yl]phenyl]-triethylsilane (PubChem CID 163651391) has the molecular formula C34H39NSSi and a molecular weight of 521.85 g/mol. Its IUPAC name is [4-[7-(4-tert-butylnaphthalen-2-yl)-3-methylthieno[2,3-c]pyridin-2-yl]phenyl]-triethylsilane.
| Compound Name | [4-[7-(4-tert-butylnaphthalen-2-yl)-3-methylthieno[2,3-c]pyridin-2-yl]phenyl]-triethylsilane |
|---|---|
| PubChem CID | 163651391 |
| Molecular Formula | C34H39NSSi |
| Molecular Weight | 521.85 g/mol |
| Exact Mass | 521.26 |
| IUPAC Name | [4-[7-(4-tert-butylnaphthalen-2-yl)-3-methylthieno[2,3-c]pyridin-2-yl]phenyl]-triethylsilane |
| SMILES | CC[Si](CC)(CC)c1ccc(-c2sc3c(-c4cc(C(C)(C)C)c5ccccc5c4)nccc3c2C)cc1 |
| InChI | InChI=1S/C34H39NSSi/c1-8-37(9-2,10-3)27-17-15-24(16-18-27)32-23(4)28-19-20-35-31(33(28)36-32)26-21-25-13-11-12-14-29(25)30(22-26)34(5,6)7/h11-22H,8-10H2,1-7H3 |
| InChIKey | JGZKLGDKYZGDMN-UHFFFAOYSA-N |
| XLogP | 10.10 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 521.85 |
| LogP ≤ 5 | 10.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|