C25H23NO2 — CID 172520345
8-(4-tert-butylnaphthalen-2-yl)-4,11-dimethyl-3,12-dioxa-7-azatricyclo[7.3.0.02,6]dodeca-1(9),2(6),4,7,10-pentaene (PubChem CID 172520345) has the molecular formula C25H23NO2 and a molecular weight of 369.46 g/mol. Its IUPAC name is 8-(4-tert-butylnaphthalen-2-yl)-4,11-dimethyl-3,12-dioxa-7-azatricyclo[7.3.0.02,6]dodeca-1(9),2(6),4,7,10-pentaene.
| Compound Name | 8-(4-tert-butylnaphthalen-2-yl)-4,11-dimethyl-3,12-dioxa-7-azatricyclo[7.3.0.02,6]dodeca-1(9),2(6),4,7,10-pentaene |
|---|---|
| PubChem CID | 172520345 |
| Molecular Formula | C25H23NO2 |
| Molecular Weight | 369.46 g/mol |
| Exact Mass | 369.17 |
| IUPAC Name | 8-(4-tert-butylnaphthalen-2-yl)-4,11-dimethyl-3,12-dioxa-7-azatricyclo[7.3.0.02,6]dodeca-1(9),2(6),4,7,10-pentaene |
| SMILES | Cc1cc2nc(-c3cc(C(C)(C)C)c4ccccc4c3)c3cc(C)oc3c2o1 |
| InChI | InChI=1S/C25H23NO2/c1-14-10-19-22(26-21-11-15(2)28-24(21)23(19)27-14)17-12-16-8-6-7-9-18(16)20(13-17)25(3,4)5/h6-13H,1-5H3 |
| InChIKey | FRFKLOQILLWSMM-UHFFFAOYSA-N |
| XLogP | 7.31 |
| TPSA | 39.17 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.46 |
| LogP ≤ 5 | 7.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |