C25H25N — CID 134387972
2-(4-tert-butylnaphthalen-2-yl)-4,5-dimethylquinoline (PubChem CID 134387972) has the molecular formula C25H25N and a molecular weight of 339.48 g/mol. Its IUPAC name is 2-(4-tert-butylnaphthalen-2-yl)-4,5-dimethylquinoline.
| Compound Name | 2-(4-tert-butylnaphthalen-2-yl)-4,5-dimethylquinoline |
|---|---|
| PubChem CID | 134387972 |
| Molecular Formula | C25H25N |
| Molecular Weight | 339.48 g/mol |
| Exact Mass | 339.20 |
| IUPAC Name | 2-(4-tert-butylnaphthalen-2-yl)-4,5-dimethylquinoline |
| SMILES | Cc1cccc2nc(-c3cc(C(C)(C)C)c4ccccc4c3)cc(C)c12 |
| InChI | InChI=1S/C25H25N/c1-16-9-8-12-22-24(16)17(2)13-23(26-22)19-14-18-10-6-7-11-20(18)21(15-19)25(3,4)5/h6-15H,1-5H3 |
| InChIKey | JIEBKWPKSYTOHR-UHFFFAOYSA-N |
| XLogP | 6.97 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.48 |
| LogP ≤ 5 | 6.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |