C32H31N — CID 170539352
2-[4-(4-tert-butylphenyl)naphthalen-2-yl]-4,5,7-trimethylquinoline (PubChem CID 170539352) has the molecular formula C32H31N and a molecular weight of 429.61 g/mol. Its IUPAC name is 2-[4-(4-tert-butylphenyl)naphthalen-2-yl]-4,5,7-trimethylquinoline.
| Compound Name | 2-[4-(4-tert-butylphenyl)naphthalen-2-yl]-4,5,7-trimethylquinoline |
|---|---|
| PubChem CID | 170539352 |
| Molecular Formula | C32H31N |
| Molecular Weight | 429.61 g/mol |
| Exact Mass | 429.25 |
| IUPAC Name | 2-[4-(4-tert-butylphenyl)naphthalen-2-yl]-4,5,7-trimethylquinoline |
| SMILES | Cc1cc(C)c2c(C)cc(-c3cc(-c4ccc(C(C)(C)C)cc4)c4ccccc4c3)nc2c1 |
| InChI | InChI=1S/C32H31N/c1-20-15-21(2)31-22(3)17-29(33-30(31)16-20)25-18-24-9-7-8-10-27(24)28(19-25)23-11-13-26(14-12-23)32(4,5)6/h7-19H,1-6H3 |
| InChIKey | TVOCFJAMYBCMAG-UHFFFAOYSA-N |
| XLogP | 8.94 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.61 |
| LogP ≤ 5 | 8.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |