C28H26N2 — CID 56931635
4-(4-tert-butylphenyl)-2-(4-methylphenyl)-9H-pyrido[2,3-b]indole (PubChem CID 56931635) has the molecular formula C28H26N2 and a molecular weight of 390.53 g/mol. Its IUPAC name is 4-(4-tert-butylphenyl)-2-(4-methylphenyl)-9H-pyrido[2,3-b]indole.
| Compound Name | 4-(4-tert-butylphenyl)-2-(4-methylphenyl)-9H-pyrido[2,3-b]indole |
|---|---|
| PubChem CID | 56931635 |
| Molecular Formula | C28H26N2 |
| Molecular Weight | 390.53 g/mol |
| Exact Mass | 390.21 |
| IUPAC Name | 4-(4-tert-butylphenyl)-2-(4-methylphenyl)-9H-pyrido[2,3-b]indole |
| SMILES | Cc1ccc(-c2cc(-c3ccc(C(C)(C)C)cc3)c3c(n2)[nH]c2ccccc23)cc1 |
| InChI | InChI=1S/C28H26N2/c1-18-9-11-20(12-10-18)25-17-23(19-13-15-21(16-14-19)28(2,3)4)26-22-7-5-6-8-24(22)29-27(26)30-25/h5-17H,1-4H3,(H,29,30) |
| InChIKey | KEACQNBLYISWGR-UHFFFAOYSA-N |
| XLogP | 7.66 |
| TPSA | 28.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.53 |
| LogP ≤ 5 | 7.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |